About carboxyiminocarbamic acid;bis(piperidine)
carboxyiminocarbamic acid;bis(piperidine) (PubChem CID 66707187) has the molecular formula C12H24N4O4
and a molecular weight of 288.35 g/mol. Its IUPAC name is carboxyiminocarbamic acid;bis(piperidine).
Molecular Properties
| Compound Name | carboxyiminocarbamic acid;bis(piperidine) |
| PubChem CID | 66707187 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | carboxyiminocarbamic acid;bis(piperidine) |
| SMILES | C1CCNCC1.C1CCNCC1.O=C(O)N=NC(=O)O |
| InChI | InChI=1S/2C5H11N.C2H2N2O4/c2*1-2-4-6-5-3-1;5-1(6)3-4-2(7)8/h2*6H,1-5H2;(H,5,6)(H,7,8) |
| InChIKey | ZDKXGMCCHIEUHM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze carboxyiminocarbamic acid;bis(piperidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxyiminocarbamic acid;bis(piperidine)?
The IUPAC name of carboxyiminocarbamic acid;bis(piperidine) (CID 66707187) is carboxyiminocarbamic acid;bis(piperidine).
What is the SMILES notation for carboxyiminocarbamic acid;bis(piperidine)?
The canonical SMILES for carboxyiminocarbamic acid;bis(piperidine) is C1CCNCC1.C1CCNCC1.O=C(O)N=NC(=O)O.
What is the InChIKey of carboxyiminocarbamic acid;bis(piperidine)?
The InChIKey is ZDKXGMCCHIEUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11N.C2H2N2O4/c2*1-2-4-6-5-3-1;5-1(6)3-4-2(7)8/h2*6H,1-5H2;(H,5,6)(H,7,8).
What are the key properties of carboxyiminocarbamic acid;bis(piperidine)?
carboxyiminocarbamic acid;bis(piperidine) has a molecular weight of 288.35 g/mol, XLogP of 2.31, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carboxyiminocarbamic acid;bis(piperidine) is sourced from PubChem (CID 66707187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).