C28H29ClF2N2O4 — CID 66707358
N-benzyl-7-chloro-N-[difluoro(phenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;butanedioic acid (PubChem CID 66707358) has the molecular formula C28H29ClF2N2O4 and a molecular weight of 531.00 g/mol. Its IUPAC name is N-benzyl-7-chloro-N-[difluoro(phenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;butanedioic acid.
| Compound Name | N-benzyl-7-chloro-N-[difluoro(phenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;butanedioic acid |
|---|---|
| PubChem CID | 66707358 |
| Molecular Formula | C28H29ClF2N2O4 |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | N-benzyl-7-chloro-N-[difluoro(phenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;butanedioic acid |
| SMILES | FC(F)(c1ccccc1)N(Cc1ccccc1)c1c(Cl)ccc2c1CCNCC2.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C24H23ClF2N2.C4H6O4/c25-22-12-11-19-13-15-28-16-14-21(19)23(22)29(17-18-7-3-1-4-8-18)24(26,27)20-9-5-2-6-10-20;5-3(6)1-2-4(7)8/h1-12,28H,13-17H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | RVPUSRGZOPOREY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|