About CID 66707390
CID 66707390 (PubChem CID 66707390) has the molecular formula C12H18BrNOSi
and a molecular weight of 300.27 g/mol.
Molecular Properties
| Compound Name | CID 66707390 |
| PubChem CID | 66707390 |
| Molecular Formula | C12H18BrNOSi |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1ccc(Br)cn1 |
| InChI | InChI=1S/C12H18BrNOSi/c1-11(2,3)16-15-12(4,5)10-7-6-9(13)8-14-10/h6-8H,1-5H3 |
| InChIKey | WZNXYAGLUUQOCL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66707390 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66707390?
The IUPAC name of CID 66707390 (CID 66707390) is not available.
What is the SMILES notation for CID 66707390?
The canonical SMILES for CID 66707390 is CC(C)(C)[Si]OC(C)(C)c1ccc(Br)cn1.
What is the InChIKey of CID 66707390?
The InChIKey is WZNXYAGLUUQOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrNOSi/c1-11(2,3)16-15-12(4,5)10-7-6-9(13)8-14-10/h6-8H,1-5H3.
What are the key properties of CID 66707390?
CID 66707390 has a molecular weight of 300.27 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66707390 is sourced from PubChem (CID 66707390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).