C33H58N4O9SSi3 — CID 66707741
5-amino-3-[(2R,3R,4R,5R)-3,4-bis(triethylsilyloxy)-5-(triethylsilyloxymethyl)oxolan-2-yl]-7-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 66707741) has the molecular formula C33H58N4O9SSi3 and a molecular weight of 771.17 g/mol. Its IUPAC name is 5-amino-3-[(2R,3R,4R,5R)-3,4-bis(triethylsilyloxy)-5-(triethylsilyloxymethyl)oxolan-2-yl]-7-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
| Compound Name | 5-amino-3-[(2R,3R,4R,5R)-3,4-bis(triethylsilyloxy)-5-(triethylsilyloxymethyl)oxolan-2-yl]-7-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 66707741 |
| Molecular Formula | C33H58N4O9SSi3 |
| Molecular Weight | 771.17 g/mol |
| Exact Mass | 770.32 |
| IUPAC Name | 5-amino-3-[(2R,3R,4R,5R)-3,4-bis(triethylsilyloxy)-5-(triethylsilyloxymethyl)oxolan-2-yl]-7-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | CC[Si](CC)(CC)OC[C@H]1O[C@@H](n2c(=O)sc3c(OCc4oc(=O)oc4C)nc(N)nc32)[C@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H58N4O9SSi3/c1-11-48(12-2,13-3)41-21-24-25(45-49(14-4,15-5)16-6)26(46-50(17-7,18-8)19-9)30(43-24)37-28-27(47-32(37)38)29(36-31(34)35-28)40-20-23-22(10)42-33(39)44-23/h24-26,30H,11-21H2,1-10H3,(H2,34,35,36)/t24-,25-,26-,30-/m1/s1 |
| InChIKey | AVRWXZBLMBCLCO-VIDGLSEISA-N |
| XLogP | 7.57 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.17 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|