C19H29NO — CID 66708199
(9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-ol (PubChem CID 66708199) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 66708199 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@@H]3C(=C1CCC2O)CCC1CC(N)C=C[C@@]13C |
| InChI | InChI=1S/C19H29NO/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,12-13,16-17,21H,3-6,8,10-11,20H2,1-2H3/t12?,13?,16-,17?,18+,19+/m1/s1 |
| InChIKey | VBYHRVYVRCRAEF-BMNOCWAKSA-N |
| XLogP | 3.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|