About 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione
8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 667085) has the molecular formula C19H22N2O5
and a molecular weight of 358.39 g/mol. Its IUPAC name is 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione.
Molecular Properties
| Compound Name | 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione |
| PubChem CID | 667085 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | COCCCn1c(C(C)C)nc2oc3cc(OC)ccc3c(=O)c2c1=O |
| InChI | InChI=1S/C19H22N2O5/c1-11(2)17-20-18-15(19(23)21(17)8-5-9-24-3)16(22)13-7-6-12(25-4)10-14(13)26-18/h6-7,10-11H,5,8-9H2,1-4H3 |
| InChIKey | PPNRUAZLHVFOEJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione?
The IUPAC name of 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione (CID 667085) is 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione.
What is the SMILES notation for 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione?
The canonical SMILES for 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione is COCCCn1c(C(C)C)nc2oc3cc(OC)ccc3c(=O)c2c1=O.
What is the InChIKey of 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione?
The InChIKey is PPNRUAZLHVFOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O5/c1-11(2)17-20-18-15(19(23)21(17)8-5-9-24-3)16(22)13-7-6-12(25-4)10-14(13)26-18/h6-7,10-11H,5,8-9H2,1-4H3.
What are the key properties of 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione?
8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione has a molecular weight of 358.39 g/mol, XLogP of 2.67, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-3-(3-methoxypropyl)-2-propan-2-ylchromeno[2,3-d]pyrimidine-4,5-dione is sourced from PubChem (CID 667085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).