C18H26O3 — CID 66708715
(1R,2S,10S,11S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadeca-3,8-diene-5,14-diol (PubChem CID 66708715) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1R,2S,10S,11S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadeca-3,8-diene-5,14-diol.
| Compound Name | (1R,2S,10S,11S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadeca-3,8-diene-5,14-diol |
|---|---|
| PubChem CID | 66708715 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1R,2S,10S,11S,15R)-2,15-dimethyl-17-oxatetracyclo[8.7.0.02,7.011,15]heptadeca-3,8-diene-5,14-diol |
| SMILES | C[C@]12C=CC(O)CC1C=C[C@@H]1[C@H]2OC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C18H26O3/c1-17-8-7-12(19)9-11(17)3-4-13-14-5-6-15(20)18(14,2)10-21-16(13)17/h3-4,7-8,11-16,19-20H,5-6,9-10H2,1-2H3/t11?,12?,13-,14-,15?,16+,17-,18-/m0/s1 |
| InChIKey | DTWONCQRBHFOBH-GDRDMVIMSA-N |
| XLogP | 2.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|