C22H22N2O2S — CID 66708859
(4R,5R)-5-[[5-(3-aminophenyl)thiophen-2-yl]-hydroxymethyl]-1-methyl-4-phenylpyrrolidin-2-one (PubChem CID 66708859) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is (4R,5R)-5-[[5-(3-aminophenyl)thiophen-2-yl]-hydroxymethyl]-1-methyl-4-phenylpyrrolidin-2-one.
| Compound Name | (4R,5R)-5-[[5-(3-aminophenyl)thiophen-2-yl]-hydroxymethyl]-1-methyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 66708859 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (4R,5R)-5-[[5-(3-aminophenyl)thiophen-2-yl]-hydroxymethyl]-1-methyl-4-phenylpyrrolidin-2-one |
| SMILES | CN1C(=O)C[C@H](c2ccccc2)[C@@H]1C(O)c1ccc(-c2cccc(N)c2)s1 |
| InChI | InChI=1S/C22H22N2O2S/c1-24-20(25)13-17(14-6-3-2-4-7-14)21(24)22(26)19-11-10-18(27-19)15-8-5-9-16(23)12-15/h2-12,17,21-22,26H,13,23H2,1H3/t17-,21-,22?/m1/s1 |
| InChIKey | OLWDETKQXKPCTB-WQHYPHNRSA-N |
| XLogP | 4.05 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|