C30H45N3O7 — CID 6670902
8-[(2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 6670902) has the molecular formula C30H45N3O7 and a molecular weight of 559.70 g/mol. Its IUPAC name is 8-[(2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 6670902 |
| Molecular Formula | C30H45N3O7 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | 8-[(2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCO[C@H]1OC(C(=O)N2CCC3(CC2)C(=O)NCN3c2ccccc2)=C[C@@H](C(C)C)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C30H45N3O7/c1-4-39-28-24(10-16-37-18-19-38-17-15-34)25(22(2)3)20-26(40-28)27(35)32-13-11-30(12-14-32)29(36)31-21-33(30)23-8-6-5-7-9-23/h5-9,20,22,24-25,28,34H,4,10-19,21H2,1-3H3,(H,31,36)/t24-,25+,28+/m1/s1 |
| InChIKey | GJWMTMIGZJZTJO-QQNWGBJXSA-N |
| XLogP | 2.52 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|