C22H23N3O4 — CID 667092
6'-methoxy-1'-methyl-1-(2-phenylethyl)spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 667092) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 6'-methoxy-1'-methyl-1-(2-phenylethyl)spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | 6'-methoxy-1'-methyl-1-(2-phenylethyl)spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 667092 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 6'-methoxy-1'-methyl-1-(2-phenylethyl)spiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | COc1ccc2c(c1)CC1(CN2C)C(=O)NC(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H23N3O4/c1-24-14-22(13-16-12-17(29-2)8-9-18(16)24)19(26)23-21(28)25(20(22)27)11-10-15-6-4-3-5-7-15/h3-9,12H,10-11,13-14H2,1-2H3,(H,23,26,28) |
| InChIKey | GXIZQLYKQSKVLN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|