C21H30S — CID 66709377
(3aS,3bS,9aS,9bS,11aS)-9a,11a-dimethyl-9-prop-2-enyl-1,2,3,3a,3b,4,7,9b,10,11-decahydroindeno[5,4-f]thiochromene (PubChem CID 66709377) has the molecular formula C21H30S and a molecular weight of 314.54 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bS,11aS)-9a,11a-dimethyl-9-prop-2-enyl-1,2,3,3a,3b,4,7,9b,10,11-decahydroindeno[5,4-f]thiochromene.
| Compound Name | (3aS,3bS,9aS,9bS,11aS)-9a,11a-dimethyl-9-prop-2-enyl-1,2,3,3a,3b,4,7,9b,10,11-decahydroindeno[5,4-f]thiochromene |
|---|---|
| PubChem CID | 66709377 |
| Molecular Formula | C21H30S |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (3aS,3bS,9aS,9bS,11aS)-9a,11a-dimethyl-9-prop-2-enyl-1,2,3,3a,3b,4,7,9b,10,11-decahydroindeno[5,4-f]thiochromene |
| SMILES | C=CCC1=CCSC2=CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@@]12C |
| InChI | InChI=1S/C21H30S/c1-4-6-15-11-14-22-19-9-8-16-17-7-5-12-20(17,2)13-10-18(16)21(15,19)3/h4,9,11,16-18H,1,5-8,10,12-14H2,2-3H3/t16-,17-,18-,20-,21+/m0/s1 |
| InChIKey | JFPQCHMROQCDLW-OAGDOXAWSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|