About ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate
ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate (PubChem CID 66709454) has the molecular formula C17H27N3O5
and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate.
Molecular Properties
| Compound Name | ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate |
| PubChem CID | 66709454 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate |
| SMILES | CCO/C(C)=N/CC(O)CNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H27N3O5/c1-3-25-13(2)18-11-14(21)12-19-15(22)7-5-4-6-10-20-16(23)8-9-17(20)24/h8-9,14,21H,3-7,10-12H2,1-2H3,(H,19,22)/b18-13+ |
| InChIKey | HFPVJFAAKJYWDS-QGOAFFKASA-N |
| XLogP | 0.40 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate?
The IUPAC name of ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate (CID 66709454) is ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate.
What is the SMILES notation for ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate?
The canonical SMILES for ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate is CCO/C(C)=N/CC(O)CNC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate?
The InChIKey is HFPVJFAAKJYWDS-QGOAFFKASA-N. The full InChI is InChI=1S/C17H27N3O5/c1-3-25-13(2)18-11-14(21)12-19-15(22)7-5-4-6-10-20-16(23)8-9-17(20)24/h8-9,14,21H,3-7,10-12H2,1-2H3,(H,19,22)/b18-13+.
What are the key properties of ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate?
ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate has a molecular weight of 353.42 g/mol, XLogP of 0.40, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2-hydroxypropyl]ethanimidate is sourced from PubChem (CID 66709454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).