C26H28O3 — CID 66709648
4-(2,6-dimethyl-4-phenylmethoxyphenyl)tricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 66709648) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-phenylmethoxyphenyl)tricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | 4-(2,6-dimethyl-4-phenylmethoxyphenyl)tricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 66709648 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-(2,6-dimethyl-4-phenylmethoxyphenyl)tricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | Cc1cc(OCc2ccccc2)cc(C)c1C1C(=O)C2C3CCC(CC3)C2C1=O |
| InChI | InChI=1S/C26H28O3/c1-15-12-20(29-14-17-6-4-3-5-7-17)13-16(2)21(15)24-25(27)22-18-8-9-19(11-10-18)23(22)26(24)28/h3-7,12-13,18-19,22-24H,8-11,14H2,1-2H3 |
| InChIKey | OHWQUULZPBOQJN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|