C13H27N5 — CID 66709652
3,6-dipentyl-2H-1,3,5-triazine-2,4-diamine (PubChem CID 66709652) has the molecular formula C13H27N5 and a molecular weight of 253.39 g/mol. Its IUPAC name is 3,6-dipentyl-2H-1,3,5-triazine-2,4-diamine.
| Compound Name | 3,6-dipentyl-2H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66709652 |
| Molecular Formula | C13H27N5 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | 3,6-dipentyl-2H-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCC1=NC(N)N(CCCCC)C(N)=N1 |
| InChI | InChI=1S/C13H27N5/c1-3-5-7-9-11-16-12(14)18(13(15)17-11)10-8-6-4-2/h12H,3-10,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | NTPSRDBIKLJNRK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|