C23H29F2N3O — CID 66709730
N,N-bis[1-amino-1-(2-fluorophenyl)propyl]cyclobutanecarboxamide (PubChem CID 66709730) has the molecular formula C23H29F2N3O and a molecular weight of 401.50 g/mol. Its IUPAC name is N,N-bis[1-amino-1-(2-fluorophenyl)propyl]cyclobutanecarboxamide.
| Compound Name | N,N-bis[1-amino-1-(2-fluorophenyl)propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 66709730 |
| Molecular Formula | C23H29F2N3O |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N,N-bis[1-amino-1-(2-fluorophenyl)propyl]cyclobutanecarboxamide |
| SMILES | CCC(N)(c1ccccc1F)N(C(=O)C1CCC1)C(N)(CC)c1ccccc1F |
| InChI | InChI=1S/C23H29F2N3O/c1-3-22(26,17-12-5-7-14-19(17)24)28(21(29)16-10-9-11-16)23(27,4-2)18-13-6-8-15-20(18)25/h5-8,12-16H,3-4,9-11,26-27H2,1-2H3 |
| InChIKey | DGPOGSDSELLBMV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|