C26H28N2O6 — CID 667098
4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-hydroxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione (PubChem CID 667098) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-hydroxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-hydroxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 667098 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-hydroxyphenyl)-1-(2-morpholin-4-ylethyl)pyrrolidine-2,3-dione |
| SMILES | CC1Cc2cc(C(O)=C3C(=O)C(=O)N(CCN4CCOCC4)C3c3cccc(O)c3)ccc2O1 |
| InChI | InChI=1S/C26H28N2O6/c1-16-13-19-14-18(5-6-21(19)34-16)24(30)22-23(17-3-2-4-20(29)15-17)28(26(32)25(22)31)8-7-27-9-11-33-12-10-27/h2-6,14-16,23,29-30H,7-13H2,1H3 |
| InChIKey | HUDXMGLAYWAIDP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|