About (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate
(triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate (PubChem CID 66709897) has the molecular formula C26H19F3O3S
and a molecular weight of 468.50 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate |
| PubChem CID | 66709897 |
| Molecular Formula | C26H19F3O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C26H19F3O3S/c27-26(28,29)19-16-17-23(24(30)18-19)25(31)32-33(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-18,30H |
| InChIKey | KUDACNGWDNGLJY-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate?
The IUPAC name of (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate (CID 66709897) is (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate.
What is the SMILES notation for (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate?
The canonical SMILES for (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate is O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1O.
What is the InChIKey of (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate?
The InChIKey is KUDACNGWDNGLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19F3O3S/c27-26(28,29)19-16-17-23(24(30)18-19)25(31)32-33(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-18,30H.
What are the key properties of (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate?
(triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate has a molecular weight of 468.50 g/mol, XLogP of 7.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (triphenyl-λ4-sulfanyl) 2-hydroxy-4-(trifluoromethyl)benzoate is sourced from PubChem (CID 66709897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).