C32H41N3O6S — CID 66710234
3-[4-[1-methyl-6-[[4-[(3S)-3-propan-2-ylmorpholine-4-carbonyl]cyclohexyl]sulfamoyl]indol-2-yl]phenyl]propanoic acid (PubChem CID 66710234) has the molecular formula C32H41N3O6S and a molecular weight of 595.76 g/mol. Its IUPAC name is 3-[4-[1-methyl-6-[[4-[(3S)-3-propan-2-ylmorpholine-4-carbonyl]cyclohexyl]sulfamoyl]indol-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[1-methyl-6-[[4-[(3S)-3-propan-2-ylmorpholine-4-carbonyl]cyclohexyl]sulfamoyl]indol-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66710234 |
| Molecular Formula | C32H41N3O6S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 3-[4-[1-methyl-6-[[4-[(3S)-3-propan-2-ylmorpholine-4-carbonyl]cyclohexyl]sulfamoyl]indol-2-yl]phenyl]propanoic acid |
| SMILES | CC(C)[C@H]1COCCN1C(=O)C1CCC(NS(=O)(=O)c2ccc3cc(-c4ccc(CCC(=O)O)cc4)n(C)c3c2)CC1 |
| InChI | InChI=1S/C32H41N3O6S/c1-21(2)30-20-41-17-16-35(30)32(38)24-9-12-26(13-10-24)33-42(39,40)27-14-11-25-18-28(34(3)29(25)19-27)23-7-4-22(5-8-23)6-15-31(36)37/h4-5,7-8,11,14,18-19,21,24,26,30,33H,6,9-10,12-13,15-17,20H2,1-3H3,(H,36,37)/t24?,26?,30-/m1/s1 |
| InChIKey | OPRFGYYFZNPURS-TVZUZJEFSA-N |
| XLogP | 4.58 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |