C36H42FN5O4 — CID 66710350
N-[(3R,4R)-3-fluoro-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-6-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]pyridine-3-carboxamide (PubChem CID 66710350) has the molecular formula C36H42FN5O4 and a molecular weight of 627.76 g/mol. Its IUPAC name is N-[(3R,4R)-3-fluoro-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-6-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]pyridine-3-carboxamide.
| Compound Name | N-[(3R,4R)-3-fluoro-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-6-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66710350 |
| Molecular Formula | C36H42FN5O4 |
| Molecular Weight | 627.76 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | N-[(3R,4R)-3-fluoro-1-[(4-pyrrolidin-1-ylphenyl)methyl]piperidin-4-yl]-6-[4-(4-methoxybenzoyl)piperidine-1-carbonyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)c3ccc(C(=O)N[C@@H]4CCN(Cc5ccc(N6CCCC6)cc5)C[C@H]4F)cn3)CC2)cc1 |
| InChI | InChI=1S/C36H42FN5O4/c1-46-30-11-6-26(7-12-30)34(43)27-14-20-42(21-15-27)36(45)33-13-8-28(22-38-33)35(44)39-32-16-19-40(24-31(32)37)23-25-4-9-29(10-5-25)41-17-2-3-18-41/h4-13,22,27,31-32H,2-3,14-21,23-24H2,1H3,(H,39,44)/t31-,32-/m1/s1 |
| InChIKey | GMBOADRJUJIWFX-ROJLCIKYSA-N |
| XLogP | 4.77 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.76 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|