C25H27ClN6O — CID 66710933
(2R)-1-[4-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 66710933) has the molecular formula C25H27ClN6O and a molecular weight of 462.99 g/mol. Its IUPAC name is (2R)-1-[4-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[4-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 66710933 |
| Molecular Formula | C25H27ClN6O |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (2R)-1-[4-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)CN1CCN(c2ccc(Nc3ncc4ccc(-c5cccc(Cl)c5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C25H27ClN6O/c1-18(33)17-30-11-13-31(14-12-30)22-7-5-21(6-8-22)28-25-27-16-23-9-10-24(32(23)29-25)19-3-2-4-20(26)15-19/h2-10,15-16,18,33H,11-14,17H2,1H3,(H,28,29)/t18-/m1/s1 |
| InChIKey | FZPQIEVZFKYBRG-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|