C30H31F4N5O5 — CID 66711329
[(2R)-3-[4-[2-fluoro-5-methoxy-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-hydroxypropyl] 2,2,2-trifluoroacetate (PubChem CID 66711329) has the molecular formula C30H31F4N5O5 and a molecular weight of 617.60 g/mol. Its IUPAC name is [(2R)-3-[4-[2-fluoro-5-methoxy-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-hydroxypropyl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R)-3-[4-[2-fluoro-5-methoxy-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-hydroxypropyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66711329 |
| Molecular Formula | C30H31F4N5O5 |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | [(2R)-3-[4-[2-fluoro-5-methoxy-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-1-yl]-2-hydroxypropyl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc(C2CCN(C[C@@H](O)COC(=O)C(F)(F)F)CC2)c(F)cc1Nc1ncc2ccc(-c3ccccc3OC)n2n1 |
| InChI | InChI=1S/C30H31F4N5O5/c1-42-26-6-4-3-5-21(26)25-8-7-19-15-35-29(37-39(19)25)36-24-14-23(31)22(13-27(24)43-2)18-9-11-38(12-10-18)16-20(40)17-44-28(41)30(32,33)34/h3-8,13-15,18,20,40H,9-12,16-17H2,1-2H3,(H,36,37)/t20-/m1/s1 |
| InChIKey | MXBXHQZBJPSBBE-HXUWFJFHSA-N |
| XLogP | 4.94 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |