C19H25N3O2Si — CID 66711679
7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1H-pyrrolo[2,1-f][1,2,4]triazin-2-one (PubChem CID 66711679) has the molecular formula C19H25N3O2Si and a molecular weight of 355.51 g/mol. Its IUPAC name is 7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1H-pyrrolo[2,1-f][1,2,4]triazin-2-one.
| Compound Name | 7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1H-pyrrolo[2,1-f][1,2,4]triazin-2-one |
|---|---|
| PubChem CID | 66711679 |
| Molecular Formula | C19H25N3O2Si |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 7-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-1H-pyrrolo[2,1-f][1,2,4]triazin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(-c2ccc3cnc(=O)[nH]n23)c1 |
| InChI | InChI=1S/C19H25N3O2Si/c1-19(2,3)25(4,5)24-13-14-7-6-8-15(11-14)17-10-9-16-12-20-18(23)21-22(16)17/h6-12H,13H2,1-5H3,(H,21,23) |
| InChIKey | KPSPNAJKNAWHGO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|