C23H21ClFN5O2 — CID 66711710
7-(5-chloro-2-methoxyphenyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 66711710) has the molecular formula C23H21ClFN5O2 and a molecular weight of 453.91 g/mol. Its IUPAC name is 7-(5-chloro-2-methoxyphenyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-(5-chloro-2-methoxyphenyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 66711710 |
| Molecular Formula | C23H21ClFN5O2 |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 7-(5-chloro-2-methoxyphenyl)-N-(3-fluoro-4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1ccc(Cl)cc1-c1ccc2cnc(Nc3ccc(N4CCOCC4)c(F)c3)nn12 |
| InChI | InChI=1S/C23H21ClFN5O2/c1-31-22-7-2-15(24)12-18(22)20-6-4-17-14-26-23(28-30(17)20)27-16-3-5-21(19(25)13-16)29-8-10-32-11-9-29/h2-7,12-14H,8-11H2,1H3,(H,27,28) |
| InChIKey | MYBQWMJTESZNPX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|