C34H32N2O6S — CID 6671175
(2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671175) has the molecular formula C34H32N2O6S and a molecular weight of 596.71 g/mol. Its IUPAC name is (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671175 |
| Molecular Formula | C34H32N2O6S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | (2R,3R,4S)-2-ethoxy-3-(3-hydroxypropyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)=C[C@H](c2coc3ccccc3c2=O)[C@H]1CCCO |
| InChI | InChI=1S/C34H32N2O6S/c1-3-40-34-23(8-6-16-37)25(26-19-41-28-9-5-4-7-24(28)31(26)38)18-29(42-34)32(39)35-22-13-11-21(12-14-22)33-36-27-15-10-20(2)17-30(27)43-33/h4-5,7,9-15,17-19,23,25,34,37H,3,6,8,16H2,1-2H3,(H,35,39)/t23-,25+,34-/m1/s1 |
| InChIKey | HXBDVQVVOQSBMO-LPNMUYAPSA-N |
| XLogP | 6.77 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |