C28H32N6O3S — CID 66711893
N-[2-[2-[(1-acetyl-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-N-methylmethanesulfonamide (PubChem CID 66711893) has the molecular formula C28H32N6O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is N-[2-[2-[(1-acetyl-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[2-[(1-acetyl-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 66711893 |
| Molecular Formula | C28H32N6O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N-[2-[2-[(1-acetyl-5,5-dimethyl-3,4-dihydro-2H-1-benzazepin-8-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]-N-methylmethanesulfonamide |
| SMILES | CC(=O)N1CCCC(C)(C)c2ccc(Nc3ncc4ccc(-c5ccccc5N(C)S(C)(=O)=O)n4n3)cc21 |
| InChI | InChI=1S/C28H32N6O3S/c1-19(35)33-16-8-15-28(2,3)23-13-11-20(17-26(23)33)30-27-29-18-21-12-14-25(34(21)31-27)22-9-6-7-10-24(22)32(4)38(5,36)37/h6-7,9-14,17-18H,8,15-16H2,1-5H3,(H,30,31) |
| InChIKey | MAHXSMDVHMFXQK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |