C26H28N6O4S — CID 66712462
N-tert-butyl-3-[2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide (PubChem CID 66712462) has the molecular formula C26H28N6O4S and a molecular weight of 520.62 g/mol. Its IUPAC name is N-tert-butyl-3-[2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide.
| Compound Name | N-tert-butyl-3-[2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 66712462 |
| Molecular Formula | C26H28N6O4S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-tert-butyl-3-[2-[(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(-c2ccc3cnc(Nc4ccc5c(c4)NC(=O)C(C)(C)O5)nn23)c1 |
| InChI | InChI=1S/C26H28N6O4S/c1-25(2,3)31-37(34,35)19-8-6-7-16(13-19)21-11-10-18-15-27-24(30-32(18)21)28-17-9-12-22-20(14-17)29-23(33)26(4,5)36-22/h6-15,31H,1-5H3,(H,28,30)(H,29,33) |
| InChIKey | UKYBDHQNYBLPCS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |