C8H8Cl4O2 — CID 66712797
[2,3,5,6-tetrachloro-6-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 66712797) has the molecular formula C8H8Cl4O2 and a molecular weight of 277.96 g/mol. Its IUPAC name is [2,3,5,6-tetrachloro-6-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | [2,3,5,6-tetrachloro-6-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 66712797 |
| Molecular Formula | C8H8Cl4O2 |
| Molecular Weight | 277.96 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | [2,3,5,6-tetrachloro-6-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | OCC1C(Cl)=C(Cl)C=C(Cl)C1(Cl)CO |
| InChI | InChI=1S/C8H8Cl4O2/c9-5-1-6(10)8(12,3-14)4(2-13)7(5)11/h1,4,13-14H,2-3H2 |
| InChIKey | HJQUTAVADMSEGE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|