About 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine
7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine (PubChem CID 66713271) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine.
Molecular Properties
| Compound Name | 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine |
| PubChem CID | 66713271 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine |
| SMILES | C=CCOc1nc(-c2ccc(OC)c(OC)c2)cc2ncccc12 |
| InChI | InChI=1S/C19H18N2O3/c1-4-10-24-19-14-6-5-9-20-16(14)12-15(21-19)13-7-8-17(22-2)18(11-13)23-3/h4-9,11-12H,1,10H2,2-3H3 |
| InChIKey | KBQNTPLWWWYYOV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine?
The IUPAC name of 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine (CID 66713271) is 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine.
What is the SMILES notation for 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine?
The canonical SMILES for 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine is C=CCOc1nc(-c2ccc(OC)c(OC)c2)cc2ncccc12.
What is the InChIKey of 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine?
The InChIKey is KBQNTPLWWWYYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-4-10-24-19-14-6-5-9-20-16(14)12-15(21-19)13-7-8-17(22-2)18(11-13)23-3/h4-9,11-12H,1,10H2,2-3H3.
What are the key properties of 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine?
7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine has a molecular weight of 322.36 g/mol, XLogP of 3.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-dimethoxyphenyl)-5-prop-2-enoxy-1,6-naphthyridine is sourced from PubChem (CID 66713271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).