About (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one
(4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one (PubChem CID 66713352) has the molecular formula C6H8F3NO2
and a molecular weight of 183.13 g/mol. Its IUPAC name is (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one |
| PubChem CID | 66713352 |
| Molecular Formula | C6H8F3NO2 |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@@H]([C@H](O)C(F)(F)F)CN1 |
| InChI | InChI=1S/C6H8F3NO2/c7-6(8,9)5(12)3-1-4(11)10-2-3/h3,5,12H,1-2H2,(H,10,11)/t3-,5+/m1/s1 |
| InChIKey | NVPCYQJAIDNIJY-WUJLRWPWSA-N |
| XLogP | 0.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one?
The IUPAC name of (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one (CID 66713352) is (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one.
What is the SMILES notation for (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one?
The canonical SMILES for (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one is O=C1C[C@@H]([C@H](O)C(F)(F)F)CN1.
What is the InChIKey of (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one?
The InChIKey is NVPCYQJAIDNIJY-WUJLRWPWSA-N. The full InChI is InChI=1S/C6H8F3NO2/c7-6(8,9)5(12)3-1-4(11)10-2-3/h3,5,12H,1-2H2,(H,10,11)/t3-,5+/m1/s1.
What are the key properties of (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one?
(4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one has a molecular weight of 183.13 g/mol, XLogP of 0.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-2-one is sourced from PubChem (CID 66713352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).