About 9-cyclobutylcarbazole
9-cyclobutylcarbazole (PubChem CID 66713557) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is 9-cyclobutylcarbazole.
Molecular Properties
| Compound Name | 9-cyclobutylcarbazole |
| PubChem CID | 66713557 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 9-cyclobutylcarbazole |
| SMILES | c1ccc2c(c1)c1ccccc1n2C1CCC1 |
| InChI | InChI=1S/C16H15N/c1-3-10-15-13(8-1)14-9-2-4-11-16(14)17(15)12-6-5-7-12/h1-4,8-12H,5-7H2 |
| InChIKey | SFBHJDZYFDQEEY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-cyclobutylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclobutylcarbazole?
The IUPAC name of 9-cyclobutylcarbazole (CID 66713557) is 9-cyclobutylcarbazole.
What is the SMILES notation for 9-cyclobutylcarbazole?
The canonical SMILES for 9-cyclobutylcarbazole is c1ccc2c(c1)c1ccccc1n2C1CCC1.
What is the InChIKey of 9-cyclobutylcarbazole?
The InChIKey is SFBHJDZYFDQEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N/c1-3-10-15-13(8-1)14-9-2-4-11-16(14)17(15)12-6-5-7-12/h1-4,8-12H,5-7H2.
What are the key properties of 9-cyclobutylcarbazole?
9-cyclobutylcarbazole has a molecular weight of 221.30 g/mol, XLogP of 4.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclobutylcarbazole is sourced from PubChem (CID 66713557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).