About 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol
6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol (PubChem CID 66713885) has the molecular formula C28H31NO2
and a molecular weight of 413.56 g/mol. Its IUPAC name is 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol.
Molecular Properties
| Compound Name | 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol |
| PubChem CID | 66713885 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1ccc(-c2ccc(OC(CCNC)c3ccccc3)cc2)c(O)c1CC=C |
| InChI | InChI=1S/C28H31NO2/c1-4-9-21-15-18-26(28(30)25(21)10-5-2)22-13-16-24(17-14-22)31-27(19-20-29-3)23-11-7-6-8-12-23/h4-8,11-18,27,29-30H,1-2,9-10,19-20H2,3H3 |
| InChIKey | BFYJQHUFVQPYKK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol?
The IUPAC name of 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol (CID 66713885) is 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol.
What is the SMILES notation for 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol?
The canonical SMILES for 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol is C=CCc1ccc(-c2ccc(OC(CCNC)c3ccccc3)cc2)c(O)c1CC=C.
What is the InChIKey of 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol?
The InChIKey is BFYJQHUFVQPYKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31NO2/c1-4-9-21-15-18-26(28(30)25(21)10-5-2)22-13-16-24(17-14-22)31-27(19-20-29-3)23-11-7-6-8-12-23/h4-8,11-18,27,29-30H,1-2,9-10,19-20H2,3H3.
What are the key properties of 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol?
6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol has a molecular weight of 413.56 g/mol, XLogP of 6.25, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[3-(methylamino)-1-phenylpropoxy]phenyl]-2,3-bis(prop-2-enyl)phenol is sourced from PubChem (CID 66713885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).