About 4-ethoxy-5,6,7,8-tetrahydroquinoline
4-ethoxy-5,6,7,8-tetrahydroquinoline (PubChem CID 66713972) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-ethoxy-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | 4-ethoxy-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 66713972 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-ethoxy-5,6,7,8-tetrahydroquinoline |
| SMILES | CCOc1ccnc2c1CCCC2 |
| InChI | InChI=1S/C11H15NO/c1-2-13-11-7-8-12-10-6-4-3-5-9(10)11/h7-8H,2-6H2,1H3 |
| InChIKey | KLGKOPUASIPSKG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxy-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-5,6,7,8-tetrahydroquinoline?
The IUPAC name of 4-ethoxy-5,6,7,8-tetrahydroquinoline (CID 66713972) is 4-ethoxy-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for 4-ethoxy-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for 4-ethoxy-5,6,7,8-tetrahydroquinoline is CCOc1ccnc2c1CCCC2.
What is the InChIKey of 4-ethoxy-5,6,7,8-tetrahydroquinoline?
The InChIKey is KLGKOPUASIPSKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-2-13-11-7-8-12-10-6-4-3-5-9(10)11/h7-8H,2-6H2,1H3.
What are the key properties of 4-ethoxy-5,6,7,8-tetrahydroquinoline?
4-ethoxy-5,6,7,8-tetrahydroquinoline has a molecular weight of 177.25 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 66713972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).