C16H26N2 — CID 66714019
1,2,2,3-tetrakis(prop-2-enyl)piperazine (PubChem CID 66714019) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1,2,2,3-tetrakis(prop-2-enyl)piperazine.
| Compound Name | 1,2,2,3-tetrakis(prop-2-enyl)piperazine |
|---|---|
| PubChem CID | 66714019 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1,2,2,3-tetrakis(prop-2-enyl)piperazine |
| SMILES | C=CCC1NCCN(CC=C)C1(CC=C)CC=C |
| InChI | InChI=1S/C16H26N2/c1-5-9-15-16(10-6-2,11-7-3)18(13-8-4)14-12-17-15/h5-8,15,17H,1-4,9-14H2 |
| InChIKey | XVFIVOHUPYPEDN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|