About ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate
ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate (PubChem CID 66714071) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate |
| PubChem CID | 66714071 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate |
| SMILES | CCOC(=O)c1onc2c1CCCC2=O |
| InChI | InChI=1S/C10H11NO4/c1-2-14-10(13)9-6-4-3-5-7(12)8(6)11-15-9/h2-5H2,1H3 |
| InChIKey | AYWOFXXNRDGSIJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate?
The IUPAC name of ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate (CID 66714071) is ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate.
What is the SMILES notation for ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate?
The canonical SMILES for ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate is CCOC(=O)c1onc2c1CCCC2=O.
What is the InChIKey of ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate?
The InChIKey is AYWOFXXNRDGSIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4/c1-2-14-10(13)9-6-4-3-5-7(12)8(6)11-15-9/h2-5H2,1H3.
What are the key properties of ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate?
ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate has a molecular weight of 209.20 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-oxo-5,6-dihydro-4H-2,1-benzoxazole-3-carboxylate is sourced from PubChem (CID 66714071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).