About 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride
4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride (PubChem CID 66714293) has the molecular formula C14H15ClN2O
and a molecular weight of 262.74 g/mol. Its IUPAC name is 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride |
| PubChem CID | 66714293 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H]1c1ccc(-c2ccc(O)cc2)cn1 |
| InChI | InChI=1S/C14H14N2O.ClH/c15-13-7-12(13)14-6-3-10(8-16-14)9-1-4-11(17)5-2-9;/h1-6,8,12-13,17H,7,15H2;1H/t12-,13-;/m1./s1 |
| InChIKey | HUXWEBAUGPFFEL-OJERSXHUSA-N |
| XLogP | 2.69 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride?
The IUPAC name of 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride (CID 66714293) is 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride.
What is the SMILES notation for 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride?
The canonical SMILES for 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride is Cl.N[C@@H]1C[C@H]1c1ccc(-c2ccc(O)cc2)cn1.
What is the InChIKey of 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride?
The InChIKey is HUXWEBAUGPFFEL-OJERSXHUSA-N. The full InChI is InChI=1S/C14H14N2O.ClH/c15-13-7-12(13)14-6-3-10(8-16-14)9-1-4-11(17)5-2-9;/h1-6,8,12-13,17H,7,15H2;1H/t12-,13-;/m1./s1.
What are the key properties of 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride?
4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride has a molecular weight of 262.74 g/mol, XLogP of 2.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-[(1R,2R)-2-aminocyclopropyl]-3-pyridinyl]phenol;hydrochloride is sourced from PubChem (CID 66714293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).