About 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride
3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride (PubChem CID 66714505) has the molecular formula C14H16Cl2N2O
and a molecular weight of 299.20 g/mol. Its IUPAC name is 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride.
Molecular Properties
| Compound Name | 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride |
| PubChem CID | 66714505 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1C[C@H]1c1ccc(-c2cccc(O)c2)nc1 |
| InChI | InChI=1S/C14H14N2O.2ClH/c15-13-7-12(13)10-4-5-14(16-8-10)9-2-1-3-11(17)6-9;;/h1-6,8,12-13,17H,7,15H2;2*1H/t12-,13+;;/m0../s1 |
| InChIKey | RGWWQGJCPULGDD-CQSOCPNPSA-N |
| XLogP | 3.11 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride?
The IUPAC name of 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride (CID 66714505) is 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride.
What is the SMILES notation for 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride?
The canonical SMILES for 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride is Cl.Cl.N[C@@H]1C[C@H]1c1ccc(-c2cccc(O)c2)nc1.
What is the InChIKey of 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride?
The InChIKey is RGWWQGJCPULGDD-CQSOCPNPSA-N. The full InChI is InChI=1S/C14H14N2O.2ClH/c15-13-7-12(13)10-4-5-14(16-8-10)9-2-1-3-11(17)6-9;;/h1-6,8,12-13,17H,7,15H2;2*1H/t12-,13+;;/m0../s1.
What are the key properties of 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride?
3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride has a molecular weight of 299.20 g/mol, XLogP of 3.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]phenol;dihydrochloride is sourced from PubChem (CID 66714505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).