About 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide
4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide (PubChem CID 66714526) has the molecular formula C15H15N3O
and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide.
Molecular Properties
| Compound Name | 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide |
| PubChem CID | 66714526 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc([C@@H]3C[C@H]3N)cn2)cc1 |
| InChI | InChI=1S/C15H15N3O/c16-13-7-12(13)11-5-6-14(18-8-11)9-1-3-10(4-2-9)15(17)19/h1-6,8,12-13H,7,16H2,(H2,17,19)/t12-,13+/m0/s1 |
| InChIKey | RMKDKZDDELSJPT-QWHCGFSZSA-N |
| XLogP | 1.66 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide?
The IUPAC name of 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide (CID 66714526) is 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide.
What is the SMILES notation for 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide?
The canonical SMILES for 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide is NC(=O)c1ccc(-c2ccc([C@@H]3C[C@H]3N)cn2)cc1.
What is the InChIKey of 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide?
The InChIKey is RMKDKZDDELSJPT-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H15N3O/c16-13-7-12(13)11-5-6-14(18-8-11)9-1-3-10(4-2-9)15(17)19/h1-6,8,12-13H,7,16H2,(H2,17,19)/t12-,13+/m0/s1.
What are the key properties of 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide?
4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide has a molecular weight of 253.30 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(1S,2R)-2-aminocyclopropyl]-2-pyridinyl]benzamide is sourced from PubChem (CID 66714526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).