C34H47N9O2 — CID 66714640
9-cyclopentyl-5,7,7-trimethyl-2-[1-(4-methylphenyl)ethylamino]-8H-pyrimido[4,5-b][1,4]diazepin-6-one;5,7,7-trimethyl-8,9-dihydropyrimido[4,5-b][1,4]diazepin-6-one (PubChem CID 66714640) has the molecular formula C34H47N9O2 and a molecular weight of 613.81 g/mol. Its IUPAC name is 9-cyclopentyl-5,7,7-trimethyl-2-[1-(4-methylphenyl)ethylamino]-8H-pyrimido[4,5-b][1,4]diazepin-6-one;5,7,7-trimethyl-8,9-dihydropyrimido[4,5-b][1,4]diazepin-6-one.
| Compound Name | 9-cyclopentyl-5,7,7-trimethyl-2-[1-(4-methylphenyl)ethylamino]-8H-pyrimido[4,5-b][1,4]diazepin-6-one;5,7,7-trimethyl-8,9-dihydropyrimido[4,5-b][1,4]diazepin-6-one |
|---|---|
| PubChem CID | 66714640 |
| Molecular Formula | C34H47N9O2 |
| Molecular Weight | 613.81 g/mol |
| Exact Mass | 613.39 |
| IUPAC Name | 9-cyclopentyl-5,7,7-trimethyl-2-[1-(4-methylphenyl)ethylamino]-8H-pyrimido[4,5-b][1,4]diazepin-6-one;5,7,7-trimethyl-8,9-dihydropyrimido[4,5-b][1,4]diazepin-6-one |
| SMILES | CN1C(=O)C(C)(C)CNc2ncncc21.Cc1ccc(C(C)Nc2ncc3c(n2)N(C2CCCC2)CC(C)(C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C24H33N5O.C10H14N4O/c1-16-10-12-18(13-11-16)17(2)26-23-25-14-20-21(27-23)29(19-8-6-7-9-19)15-24(3,4)22(30)28(20)5;1-10(2)5-12-8-7(4-11-6-13-8)14(3)9(10)15/h10-14,17,19H,6-9,15H2,1-5H3,(H,25,26,27);4,6H,5H2,1-3H3,(H,11,12,13) |
| InChIKey | GHTSNLCAZZGCFM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |