About 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol
3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol (PubChem CID 66714940) has the molecular formula C20H20N4O
and a molecular weight of 332.41 g/mol. Its IUPAC name is 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol.
Molecular Properties
| Compound Name | 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol |
| PubChem CID | 66714940 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol |
| SMILES | Nc1ncc(CN[C@@H]2C[C@H]2c2ccc(-c3cccc(O)c3)cc2)cn1 |
| InChI | InChI=1S/C20H20N4O/c21-20-23-11-13(12-24-20)10-22-19-9-18(19)15-6-4-14(5-7-15)16-2-1-3-17(25)8-16/h1-8,11-12,18-19,22,25H,9-10H2,(H2,21,23,24)/t18-,19+/m0/s1 |
| InChIKey | LHGWKSSSHJWPDK-RBUKOAKNSA-N |
| XLogP | 3.08 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol?
The IUPAC name of 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol (CID 66714940) is 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol.
What is the SMILES notation for 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol?
The canonical SMILES for 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol is Nc1ncc(CN[C@@H]2C[C@H]2c2ccc(-c3cccc(O)c3)cc2)cn1.
What is the InChIKey of 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol?
The InChIKey is LHGWKSSSHJWPDK-RBUKOAKNSA-N. The full InChI is InChI=1S/C20H20N4O/c21-20-23-11-13(12-24-20)10-22-19-9-18(19)15-6-4-14(5-7-15)16-2-1-3-17(25)8-16/h1-8,11-12,18-19,22,25H,9-10H2,(H2,21,23,24)/t18-,19+/m0/s1.
What are the key properties of 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol?
3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol has a molecular weight of 332.41 g/mol, XLogP of 3.08, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(1S,2R)-2-[(2-aminopyrimidin-5-yl)methylamino]cyclopropyl]phenyl]phenol is sourced from PubChem (CID 66714940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).