About triazolo[4,5-i][1,2]benzodiazepine
triazolo[4,5-i][1,2]benzodiazepine (PubChem CID 66714960) has the molecular formula C9H5N5
and a molecular weight of 183.17 g/mol. Its IUPAC name is triazolo[4,5-i][1,2]benzodiazepine.
Molecular Properties
| Compound Name | triazolo[4,5-i][1,2]benzodiazepine |
| PubChem CID | 66714960 |
| Molecular Formula | C9H5N5 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | triazolo[4,5-i][1,2]benzodiazepine |
| SMILES | c1cnnc2c(c1)ccc1nnnc12 |
| InChI | InChI=1S/C9H5N5/c1-2-6-3-4-7-9(13-14-11-7)8(6)12-10-5-1/h1-5H |
| InChIKey | KYTREVLPRJOBEM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze triazolo[4,5-i][1,2]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[4,5-i][1,2]benzodiazepine?
The IUPAC name of triazolo[4,5-i][1,2]benzodiazepine (CID 66714960) is triazolo[4,5-i][1,2]benzodiazepine.
What is the SMILES notation for triazolo[4,5-i][1,2]benzodiazepine?
The canonical SMILES for triazolo[4,5-i][1,2]benzodiazepine is c1cnnc2c(c1)ccc1nnnc12.
What is the InChIKey of triazolo[4,5-i][1,2]benzodiazepine?
The InChIKey is KYTREVLPRJOBEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N5/c1-2-6-3-4-7-9(13-14-11-7)8(6)12-10-5-1/h1-5H.
What are the key properties of triazolo[4,5-i][1,2]benzodiazepine?
triazolo[4,5-i][1,2]benzodiazepine has a molecular weight of 183.17 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[4,5-i][1,2]benzodiazepine is sourced from PubChem (CID 66714960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).