About 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid
3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid (PubChem CID 66715751) has the molecular formula C18H24N4O3
and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid |
| PubChem CID | 66715751 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C(=O)n1ncc2cc(NC3CCCN(C(=O)O)C3)ccc21 |
| InChI | InChI=1S/C18H24N4O3/c1-18(2,3)16(23)22-15-7-6-13(9-12(15)10-19-22)20-14-5-4-8-21(11-14)17(24)25/h6-7,9-10,14,20H,4-5,8,11H2,1-3H3,(H,24,25) |
| InChIKey | MIEXRCIWLPPLNA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid?
The IUPAC name of 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid (CID 66715751) is 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid.
What is the SMILES notation for 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid?
The canonical SMILES for 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid is CC(C)(C)C(=O)n1ncc2cc(NC3CCCN(C(=O)O)C3)ccc21.
What is the InChIKey of 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid?
The InChIKey is MIEXRCIWLPPLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-18(2,3)16(23)22-15-7-6-13(9-12(15)10-19-22)20-14-5-4-8-21(11-14)17(24)25/h6-7,9-10,14,20H,4-5,8,11H2,1-3H3,(H,24,25).
What are the key properties of 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid?
3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid has a molecular weight of 344.42 g/mol, XLogP of 3.28, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylic acid is sourced from PubChem (CID 66715751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).