About propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate
propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 667163) has the molecular formula C19H21N3O2S2
and a molecular weight of 387.53 g/mol. Its IUPAC name is propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| PubChem CID | 667163 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | Cc1ccc(-n2c(Cc3cccs3)nnc2SCC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-13(2)24-18(23)12-26-19-21-20-17(11-16-5-4-10-25-16)22(19)15-8-6-14(3)7-9-15/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | JUTYTXKNTXTFCM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate?
The IUPAC name of propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate (CID 667163) is propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
What is the SMILES notation for propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate?
The canonical SMILES for propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate is Cc1ccc(-n2c(Cc3cccs3)nnc2SCC(=O)OC(C)C)cc1.
What is the InChIKey of propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate?
The InChIKey is JUTYTXKNTXTFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2S2/c1-13(2)24-18(23)12-26-19-21-20-17(11-16-5-4-10-25-16)22(19)15-8-6-14(3)7-9-15/h4-10,13H,11-12H2,1-3H3.
What are the key properties of propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate?
propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate has a molecular weight of 387.53 g/mol, XLogP of 4.27, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[[4-(4-methylphenyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetate is sourced from PubChem (CID 667163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).