About 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol
4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol (PubChem CID 66716348) has the molecular formula C22H23Cl2N3O2S
and a molecular weight of 464.42 g/mol. Its IUPAC name is 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol.
Molecular Properties
| Compound Name | 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol |
| PubChem CID | 66716348 |
| Molecular Formula | C22H23Cl2N3O2S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol |
| SMILES | CS(=O)c1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)cc2c1NC1CCC(N)CC1 |
| InChI | InChI=1S/C22H23Cl2N3O2S/c1-30(29)20-11-26-19-7-2-12(13-9-17(23)22(28)18(24)10-13)8-16(19)21(20)27-15-5-3-14(25)4-6-15/h2,7-11,14-15,28H,3-6,25H2,1H3,(H,26,27) |
| InChIKey | LMMMURGEOQJINQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol?
The IUPAC name of 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol (CID 66716348) is 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol.
What is the SMILES notation for 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol?
The canonical SMILES for 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol is CS(=O)c1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)cc2c1NC1CCC(N)CC1.
What is the InChIKey of 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol?
The InChIKey is LMMMURGEOQJINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23Cl2N3O2S/c1-30(29)20-11-26-19-7-2-12(13-9-17(23)22(28)18(24)10-13)8-16(19)21(20)27-15-5-3-14(25)4-6-15/h2,7-11,14-15,28H,3-6,25H2,1H3,(H,26,27).
What are the key properties of 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol?
4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol has a molecular weight of 464.42 g/mol, XLogP of 5.33, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(4-aminocyclohexyl)amino]-3-methylsulfinylquinolin-6-yl]-2,6-dichlorophenol is sourced from PubChem (CID 66716348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).