C7H9NOS — CID 66716459
4-methoxy-2-prop-2-enyl-1,3-thiazole (PubChem CID 66716459) has the molecular formula C7H9NOS and a molecular weight of 155.22 g/mol. Its IUPAC name is 4-methoxy-2-prop-2-enyl-1,3-thiazole.
| Compound Name | 4-methoxy-2-prop-2-enyl-1,3-thiazole |
|---|---|
| PubChem CID | 66716459 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 4-methoxy-2-prop-2-enyl-1,3-thiazole |
| SMILES | C=CCc1nc(OC)cs1 |
| InChI | InChI=1S/C7H9NOS/c1-3-4-7-8-6(9-2)5-10-7/h3,5H,1,4H2,2H3 |
| InChIKey | OMEUPGXAUGNOEK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|