About 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide
3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 66716630) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 66716630 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | COC1=CC(C(N)=O)C(C)(OC)C(c2ccccc2)=C1 |
| InChI | InChI=1S/C16H19NO3/c1-16(20-3)13(11-7-5-4-6-8-11)9-12(19-2)10-14(16)15(17)18/h4-10,14H,1-3H3,(H2,17,18) |
| InChIKey | JNPWSNRLZGKRQF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide (CID 66716630) is 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide is COC1=CC(C(N)=O)C(C)(OC)C(c2ccccc2)=C1.
What is the InChIKey of 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide?
The InChIKey is JNPWSNRLZGKRQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-16(20-3)13(11-7-5-4-6-8-11)9-12(19-2)10-14(16)15(17)18/h4-10,14H,1-3H3,(H2,17,18).
What are the key properties of 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide?
3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide has a molecular weight of 273.33 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethoxy-6-methyl-5-phenylcyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 66716630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).