About 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine
3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine (PubChem CID 66716913) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine |
| PubChem CID | 66716913 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine |
| SMILES | CN1C=C(CCCN)N(C)C1 |
| InChI | InChI=1S/C8H17N3/c1-10-6-8(4-3-5-9)11(2)7-10/h6H,3-5,7,9H2,1-2H3 |
| InChIKey | HFTYRKHQJOJELT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine?
The IUPAC name of 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine (CID 66716913) is 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine.
What is the SMILES notation for 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine?
The canonical SMILES for 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine is CN1C=C(CCCN)N(C)C1.
What is the InChIKey of 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine?
The InChIKey is HFTYRKHQJOJELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-10-6-8(4-3-5-9)11(2)7-10/h6H,3-5,7,9H2,1-2H3.
What are the key properties of 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine?
3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine has a molecular weight of 155.24 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dimethyl-2H-imidazol-4-yl)propan-1-amine is sourced from PubChem (CID 66716913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).