C30H25N5O5 — CID 66716966
2-(4-nitrophenyl)ethyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 66716966) has the molecular formula C30H25N5O5 and a molecular weight of 535.56 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | 2-(4-nitrophenyl)ethyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 66716966 |
| Molecular Formula | C30H25N5O5 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | O=C(OCCc1ccc([N+](=O)[O-])cc1)C1Cc2c(ccc3c2ccn3C(=O)C2Cc3c(ccc4[nH]ccc34)N2)N1 |
| InChI | InChI=1S/C30H25N5O5/c36-29(26-15-21-19-9-12-31-23(19)5-6-24(21)32-26)34-13-10-20-22-16-27(33-25(22)7-8-28(20)34)30(37)40-14-11-17-1-3-18(4-2-17)35(38)39/h1-10,12-13,26-27,31-33H,11,14-16H2 |
| InChIKey | FAFQYYNKDLXNSI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|