C12H11IN4S — CID 66717116
3-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-N,N-dimethylaniline (PubChem CID 66717116) has the molecular formula C12H11IN4S and a molecular weight of 370.22 g/mol. Its IUPAC name is 3-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-N,N-dimethylaniline.
| Compound Name | 3-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 66717116 |
| Molecular Formula | C12H11IN4S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 3-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-c2nn3cc(I)nc3s2)c1 |
| InChI | InChI=1S/C12H11IN4S/c1-16(2)9-5-3-4-8(6-9)11-15-17-7-10(13)14-12(17)18-11/h3-7H,1-2H3 |
| InChIKey | WRBPHGDWOPCQKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|