C10H16N2 — CID 66717231
1-N,1-N,2,4-tetramethylbenzene-1,3-diamine (PubChem CID 66717231) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-N,1-N,2,4-tetramethylbenzene-1,3-diamine.
| Compound Name | 1-N,1-N,2,4-tetramethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 66717231 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-N,1-N,2,4-tetramethylbenzene-1,3-diamine |
| SMILES | Cc1ccc(N(C)C)c(C)c1N |
| InChI | InChI=1S/C10H16N2/c1-7-5-6-9(12(3)4)8(2)10(7)11/h5-6H,11H2,1-4H3 |
| InChIKey | ICZPOMBZKROYIH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|