C20H20N2O3S2 — CID 66717288
3-(phenylsulfamoyl)-N-(2,4,6-trimethylphenyl)thiophene-2-carboxamide (PubChem CID 66717288) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-(phenylsulfamoyl)-N-(2,4,6-trimethylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-(phenylsulfamoyl)-N-(2,4,6-trimethylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 66717288 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 3-(phenylsulfamoyl)-N-(2,4,6-trimethylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H20N2O3S2/c1-13-11-14(2)18(15(3)12-13)21-20(23)19-17(9-10-26-19)27(24,25)22-16-7-5-4-6-8-16/h4-12,22H,1-3H3,(H,21,23) |
| InChIKey | CBNQYWFVDPZFKF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |